C14H22N4O — CID 83005153
6-(cyclopropylmethoxy)-2-N-piperidin-1-ylpyridine-2,5-diamine (PubChem CID 83005153) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 6-(cyclopropylmethoxy)-2-N-piperidin-1-ylpyridine-2,5-diamine.
| Compound Name | 6-(cyclopropylmethoxy)-2-N-piperidin-1-ylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 83005153 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 6-(cyclopropylmethoxy)-2-N-piperidin-1-ylpyridine-2,5-diamine |
| SMILES | Nc1ccc(NN2CCCCC2)nc1OCC1CC1 |
| InChI | InChI=1S/C14H22N4O/c15-12-6-7-13(17-18-8-2-1-3-9-18)16-14(12)19-10-11-4-5-11/h6-7,11H,1-5,8-10,15H2,(H,16,17) |
| InChIKey | QDEXUBPFVIYCBK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |