C16H19ClN2S — CID 43264408
N-[[3-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]-N-ethylcyclopropanamine (PubChem CID 43264408) has the molecular formula C16H19ClN2S and a molecular weight of 306.86 g/mol. Its IUPAC name is N-[[3-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]-N-ethylcyclopropanamine.
| Compound Name | N-[[3-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]-N-ethylcyclopropanamine |
|---|---|
| PubChem CID | 43264408 |
| Molecular Formula | C16H19ClN2S |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-[[3-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]-N-ethylcyclopropanamine |
| SMILES | CCN(Cc1cccc(-c2nc(CCl)cs2)c1)C1CC1 |
| InChI | InChI=1S/C16H19ClN2S/c1-2-19(15-6-7-15)10-12-4-3-5-13(8-12)16-18-14(9-17)11-20-16/h3-5,8,11,15H,2,6-7,9-10H2,1H3 |
| InChIKey | DSOCLMIJFUUZMI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|