C17H23ClN2S — CID 63965317
N-[[3-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]-N,2-dimethylbutan-2-amine (PubChem CID 63965317) has the molecular formula C17H23ClN2S and a molecular weight of 322.91 g/mol. Its IUPAC name is N-[[3-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]-N,2-dimethylbutan-2-amine.
| Compound Name | N-[[3-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]-N,2-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 63965317 |
| Molecular Formula | C17H23ClN2S |
| Molecular Weight | 322.91 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[[3-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]-N,2-dimethylbutan-2-amine |
| SMILES | CCC(C)(C)N(C)Cc1cccc(-c2nc(CCl)cs2)c1 |
| InChI | InChI=1S/C17H23ClN2S/c1-5-17(2,3)20(4)11-13-7-6-8-14(9-13)16-19-15(10-18)12-21-16/h6-9,12H,5,10-11H2,1-4H3 |
| InChIKey | BKIOIFLILGJQNF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.91 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|