C15H17ClN2O2S — CID 104553239
3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(1-hydroxypropan-2-yl)-N-methylbenzamide (PubChem CID 104553239) has the molecular formula C15H17ClN2O2S and a molecular weight of 324.83 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(1-hydroxypropan-2-yl)-N-methylbenzamide.
| Compound Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(1-hydroxypropan-2-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 104553239 |
| Molecular Formula | C15H17ClN2O2S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(1-hydroxypropan-2-yl)-N-methylbenzamide |
| SMILES | CC(CO)N(C)C(=O)c1cccc(-c2nc(CCl)cs2)c1 |
| InChI | InChI=1S/C15H17ClN2O2S/c1-10(8-19)18(2)15(20)12-5-3-4-11(6-12)14-17-13(7-16)9-21-14/h3-6,9-10,19H,7-8H2,1-2H3 |
| InChIKey | LYZDFAXZVJIRFB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|