C13H9ClN4OS2 — CID 114913575
3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(thiadiazol-5-yl)benzamide (PubChem CID 114913575) has the molecular formula C13H9ClN4OS2 and a molecular weight of 336.83 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(thiadiazol-5-yl)benzamide.
| Compound Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(thiadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 114913575 |
| Molecular Formula | C13H9ClN4OS2 |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(thiadiazol-5-yl)benzamide |
| SMILES | O=C(Nc1cnns1)c1cccc(-c2nc(CCl)cs2)c1 |
| InChI | InChI=1S/C13H9ClN4OS2/c14-5-10-7-20-13(16-10)9-3-1-2-8(4-9)12(19)17-11-6-15-18-21-11/h1-4,6-7H,5H2,(H,17,19) |
| InChIKey | DRWHIYAHIRJWBG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|