C14H15ClN2O2S — CID 43319999
3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2-methoxyethyl)benzamide (PubChem CID 43319999) has the molecular formula C14H15ClN2O2S and a molecular weight of 310.81 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 43319999 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc(-c2nc(CCl)cs2)c1 |
| InChI | InChI=1S/C14H15ClN2O2S/c1-19-6-5-16-13(18)10-3-2-4-11(7-10)14-17-12(8-15)9-20-14/h2-4,7,9H,5-6,8H2,1H3,(H,16,18) |
| InChIKey | HDKHXAOXULVEGZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|