C11H16N2O2 — CID 43269021
2-[ethyl(propyl)amino]pyridine-4-carboxylic acid (PubChem CID 43269021) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-[ethyl(propyl)amino]pyridine-4-carboxylic acid.
| Compound Name | 2-[ethyl(propyl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 43269021 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-[ethyl(propyl)amino]pyridine-4-carboxylic acid |
| SMILES | CCCN(CC)c1cc(C(=O)O)ccn1 |
| InChI | InChI=1S/C11H16N2O2/c1-3-7-13(4-2)10-8-9(11(14)15)5-6-12-10/h5-6,8H,3-4,7H2,1-2H3,(H,14,15) |
| InChIKey | KKYCASDSPOVFMA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |