C12H19N3 — CID 142584309
4-(1-aminoethenyl)-N-ethyl-N-propylpyridin-2-amine (PubChem CID 142584309) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-(1-aminoethenyl)-N-ethyl-N-propylpyridin-2-amine.
| Compound Name | 4-(1-aminoethenyl)-N-ethyl-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 142584309 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 4-(1-aminoethenyl)-N-ethyl-N-propylpyridin-2-amine |
| SMILES | C=C(N)c1ccnc(N(CC)CCC)c1 |
| InChI | InChI=1S/C12H19N3/c1-4-8-15(5-2)12-9-11(10(3)13)6-7-14-12/h6-7,9H,3-5,8,13H2,1-2H3 |
| InChIKey | MCOHLLARJCTJRI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |