C18H22N2O — CID 43275450
N-[4-(aminomethyl)phenyl]-N,2-dimethyl-2-phenylpropanamide (PubChem CID 43275450) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]-N,2-dimethyl-2-phenylpropanamide.
| Compound Name | N-[4-(aminomethyl)phenyl]-N,2-dimethyl-2-phenylpropanamide |
|---|---|
| PubChem CID | 43275450 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]-N,2-dimethyl-2-phenylpropanamide |
| SMILES | CN(C(=O)C(C)(C)c1ccccc1)c1ccc(CN)cc1 |
| InChI | InChI=1S/C18H22N2O/c1-18(2,15-7-5-4-6-8-15)17(21)20(3)16-11-9-14(13-19)10-12-16/h4-12H,13,19H2,1-3H3 |
| InChIKey | GZGWXFGNYXWJQZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |