C16H25ClN2O2 — CID 43278038
2-[4-chloro-2-[(propan-2-ylamino)methyl]phenoxy]-N-propylpropanamide (PubChem CID 43278038) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 2-[4-chloro-2-[(propan-2-ylamino)methyl]phenoxy]-N-propylpropanamide.
| Compound Name | 2-[4-chloro-2-[(propan-2-ylamino)methyl]phenoxy]-N-propylpropanamide |
|---|---|
| PubChem CID | 43278038 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-[4-chloro-2-[(propan-2-ylamino)methyl]phenoxy]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)Oc1ccc(Cl)cc1CNC(C)C |
| InChI | InChI=1S/C16H25ClN2O2/c1-5-8-18-16(20)12(4)21-15-7-6-14(17)9-13(15)10-19-11(2)3/h6-7,9,11-12,19H,5,8,10H2,1-4H3,(H,18,20) |
| InChIKey | NNUBTVBIHQKIPX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |