C17H17NO3 — CID 43282414
N-[[4-(1,3-benzodioxol-5-yloxy)phenyl]methyl]cyclopropanamine (PubChem CID 43282414) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-[[4-(1,3-benzodioxol-5-yloxy)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-(1,3-benzodioxol-5-yloxy)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 43282414 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-[[4-(1,3-benzodioxol-5-yloxy)phenyl]methyl]cyclopropanamine |
| SMILES | c1cc(Oc2ccc3c(c2)OCO3)ccc1CNC1CC1 |
| InChI | InChI=1S/C17H17NO3/c1-5-14(6-2-12(1)10-18-13-3-4-13)21-15-7-8-16-17(9-15)20-11-19-16/h1-2,5-9,13,18H,3-4,10-11H2 |
| InChIKey | MBZNOGWAVHKGEC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |