C14H14Cl3NS — CID 43287438
N-[[5-(2,4,5-trichlorophenyl)thiophen-2-yl]methyl]propan-1-amine (PubChem CID 43287438) has the molecular formula C14H14Cl3NS and a molecular weight of 334.70 g/mol. Its IUPAC name is N-[[5-(2,4,5-trichlorophenyl)thiophen-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(2,4,5-trichlorophenyl)thiophen-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 43287438 |
| Molecular Formula | C14H14Cl3NS |
| Molecular Weight | 334.70 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | N-[[5-(2,4,5-trichlorophenyl)thiophen-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(-c2cc(Cl)c(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C14H14Cl3NS/c1-2-5-18-8-9-3-4-14(19-9)10-6-12(16)13(17)7-11(10)15/h3-4,6-7,18H,2,5,8H2,1H3 |
| InChIKey | OPZHXVMBYWWTHK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.70 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|