C14H14ClN3S2 — CID 65474344
N-[[5-(5-chloro-2,1,3-benzothiadiazol-4-yl)thiophen-2-yl]methyl]propan-1-amine (PubChem CID 65474344) has the molecular formula C14H14ClN3S2 and a molecular weight of 323.87 g/mol. Its IUPAC name is N-[[5-(5-chloro-2,1,3-benzothiadiazol-4-yl)thiophen-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(5-chloro-2,1,3-benzothiadiazol-4-yl)thiophen-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 65474344 |
| Molecular Formula | C14H14ClN3S2 |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | N-[[5-(5-chloro-2,1,3-benzothiadiazol-4-yl)thiophen-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(-c2c(Cl)ccc3nsnc23)s1 |
| InChI | InChI=1S/C14H14ClN3S2/c1-2-7-16-8-9-3-6-12(19-9)13-10(15)4-5-11-14(13)18-20-17-11/h3-6,16H,2,7-8H2,1H3 |
| InChIKey | GYYBYUXLDVGUKW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|