C12H13ClN6S — CID 107451669
N-[[3-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine (PubChem CID 107451669) has the molecular formula C12H13ClN6S and a molecular weight of 308.80 g/mol. Its IUPAC name is N-[[3-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[3-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107451669 |
| Molecular Formula | C12H13ClN6S |
| Molecular Weight | 308.80 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | N-[[3-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnnn1-c1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C12H13ClN6S/c1-2-5-14-6-8-7-15-18-19(8)12-9(13)3-4-10-11(12)17-20-16-10/h3-4,7,14H,2,5-6H2,1H3 |
| InChIKey | OGTTZJISYUOLHH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|