C14H17N5 — CID 107451569
4-methyl-3-[5-(propylaminomethyl)triazol-1-yl]benzonitrile (PubChem CID 107451569) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is 4-methyl-3-[5-(propylaminomethyl)triazol-1-yl]benzonitrile.
| Compound Name | 4-methyl-3-[5-(propylaminomethyl)triazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 107451569 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 4-methyl-3-[5-(propylaminomethyl)triazol-1-yl]benzonitrile |
| SMILES | CCCNCc1cnnn1-c1cc(C#N)ccc1C |
| InChI | InChI=1S/C14H17N5/c1-3-6-16-9-13-10-17-18-19(13)14-7-12(8-15)5-4-11(14)2/h4-5,7,10,16H,3,6,9H2,1-2H3 |
| InChIKey | YFANQVXFQROOMN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|