C12H13F3N4 — CID 107451596
N-[[3-(2,4,5-trifluorophenyl)triazol-4-yl]methyl]propan-1-amine (PubChem CID 107451596) has the molecular formula C12H13F3N4 and a molecular weight of 270.26 g/mol. Its IUPAC name is N-[[3-(2,4,5-trifluorophenyl)triazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[3-(2,4,5-trifluorophenyl)triazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107451596 |
| Molecular Formula | C12H13F3N4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-[[3-(2,4,5-trifluorophenyl)triazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnnn1-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H13F3N4/c1-2-3-16-6-8-7-17-18-19(8)12-5-10(14)9(13)4-11(12)15/h4-5,7,16H,2-3,6H2,1H3 |
| InChIKey | QYDLTZPLVRSUEP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|