C10H10BrFN4 — CID 107451386
1-[3-(4-bromo-2-fluorophenyl)triazol-4-yl]-N-methylmethanamine (PubChem CID 107451386) has the molecular formula C10H10BrFN4 and a molecular weight of 285.12 g/mol. Its IUPAC name is 1-[3-(4-bromo-2-fluorophenyl)triazol-4-yl]-N-methylmethanamine.
| Compound Name | 1-[3-(4-bromo-2-fluorophenyl)triazol-4-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 107451386 |
| Molecular Formula | C10H10BrFN4 |
| Molecular Weight | 285.12 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 1-[3-(4-bromo-2-fluorophenyl)triazol-4-yl]-N-methylmethanamine |
| SMILES | CNCc1cnnn1-c1ccc(Br)cc1F |
| InChI | InChI=1S/C10H10BrFN4/c1-13-5-8-6-14-15-16(8)10-3-2-7(11)4-9(10)12/h2-4,6,13H,5H2,1H3 |
| InChIKey | AKQCNMQOZDARKQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.12 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |