C18H25NS — CID 43287695
N-[1-[5-(2-propan-2-ylphenyl)thiophen-2-yl]ethyl]propan-1-amine (PubChem CID 43287695) has the molecular formula C18H25NS and a molecular weight of 287.47 g/mol. Its IUPAC name is N-[1-[5-(2-propan-2-ylphenyl)thiophen-2-yl]ethyl]propan-1-amine.
| Compound Name | N-[1-[5-(2-propan-2-ylphenyl)thiophen-2-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 43287695 |
| Molecular Formula | C18H25NS |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[1-[5-(2-propan-2-ylphenyl)thiophen-2-yl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1ccc(-c2ccccc2C(C)C)s1 |
| InChI | InChI=1S/C18H25NS/c1-5-12-19-14(4)17-10-11-18(20-17)16-9-7-6-8-15(16)13(2)3/h6-11,13-14,19H,5,12H2,1-4H3 |
| InChIKey | HREAWMKDFGRLLE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |