C16H20ClNOS — CID 63400734
N-[1-[5-(2-chloro-5-methoxyphenyl)thiophen-2-yl]ethyl]propan-1-amine (PubChem CID 63400734) has the molecular formula C16H20ClNOS and a molecular weight of 309.86 g/mol. Its IUPAC name is N-[1-[5-(2-chloro-5-methoxyphenyl)thiophen-2-yl]ethyl]propan-1-amine.
| Compound Name | N-[1-[5-(2-chloro-5-methoxyphenyl)thiophen-2-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 63400734 |
| Molecular Formula | C16H20ClNOS |
| Molecular Weight | 309.86 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-[1-[5-(2-chloro-5-methoxyphenyl)thiophen-2-yl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1ccc(-c2cc(OC)ccc2Cl)s1 |
| InChI | InChI=1S/C16H20ClNOS/c1-4-9-18-11(2)15-7-8-16(20-15)13-10-12(19-3)5-6-14(13)17/h5-8,10-11,18H,4,9H2,1-3H3 |
| InChIKey | SFWUITPUZIIDQW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.86 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |