C10H16ClNS — CID 102764194
N-[1-(5-chloro-4-methylthiophen-2-yl)ethyl]propan-1-amine (PubChem CID 102764194) has the molecular formula C10H16ClNS and a molecular weight of 217.76 g/mol. Its IUPAC name is N-[1-(5-chloro-4-methylthiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(5-chloro-4-methylthiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 102764194 |
| Molecular Formula | C10H16ClNS |
| Molecular Weight | 217.76 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | N-[1-(5-chloro-4-methylthiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1cc(C)c(Cl)s1 |
| InChI | InChI=1S/C10H16ClNS/c1-4-5-12-8(3)9-6-7(2)10(11)13-9/h6,8,12H,4-5H2,1-3H3 |
| InChIKey | ROEPNMAVTWIHDD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.76 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |