C13H22ClNO2S2 — CID 102764212
1-(5-chloro-4-methylthiophen-2-yl)-2-methyl-2-methylsulfonyl-N-propylpropan-1-amine (PubChem CID 102764212) has the molecular formula C13H22ClNO2S2 and a molecular weight of 323.91 g/mol. Its IUPAC name is 1-(5-chloro-4-methylthiophen-2-yl)-2-methyl-2-methylsulfonyl-N-propylpropan-1-amine.
| Compound Name | 1-(5-chloro-4-methylthiophen-2-yl)-2-methyl-2-methylsulfonyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 102764212 |
| Molecular Formula | C13H22ClNO2S2 |
| Molecular Weight | 323.91 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1-(5-chloro-4-methylthiophen-2-yl)-2-methyl-2-methylsulfonyl-N-propylpropan-1-amine |
| SMILES | CCCNC(c1cc(C)c(Cl)s1)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C13H22ClNO2S2/c1-6-7-15-11(13(3,4)19(5,16)17)10-8-9(2)12(14)18-10/h8,11,15H,6-7H2,1-5H3 |
| InChIKey | HGXOCTUKXJOMCN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.91 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |