C10H15ClO3S2 — CID 102764411
1-(5-chloro-4-methylthiophen-2-yl)-2-methyl-2-methylsulfonylpropan-1-ol (PubChem CID 102764411) has the molecular formula C10H15ClO3S2 and a molecular weight of 282.81 g/mol. Its IUPAC name is 1-(5-chloro-4-methylthiophen-2-yl)-2-methyl-2-methylsulfonylpropan-1-ol.
| Compound Name | 1-(5-chloro-4-methylthiophen-2-yl)-2-methyl-2-methylsulfonylpropan-1-ol |
|---|---|
| PubChem CID | 102764411 |
| Molecular Formula | C10H15ClO3S2 |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 1-(5-chloro-4-methylthiophen-2-yl)-2-methyl-2-methylsulfonylpropan-1-ol |
| SMILES | Cc1cc(C(O)C(C)(C)S(C)(=O)=O)sc1Cl |
| InChI | InChI=1S/C10H15ClO3S2/c1-6-5-7(15-9(6)11)8(12)10(2,3)16(4,13)14/h5,8,12H,1-4H3 |
| InChIKey | IZYLZFBPFMASJV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |