C17H21ClFNS — CID 43287835
1-[5-(2-chloro-4-fluorophenyl)thiophen-2-yl]-2-methyl-N-propylpropan-1-amine (PubChem CID 43287835) has the molecular formula C17H21ClFNS and a molecular weight of 325.88 g/mol. Its IUPAC name is 1-[5-(2-chloro-4-fluorophenyl)thiophen-2-yl]-2-methyl-N-propylpropan-1-amine.
| Compound Name | 1-[5-(2-chloro-4-fluorophenyl)thiophen-2-yl]-2-methyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 43287835 |
| Molecular Formula | C17H21ClFNS |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-[5-(2-chloro-4-fluorophenyl)thiophen-2-yl]-2-methyl-N-propylpropan-1-amine |
| SMILES | CCCNC(c1ccc(-c2ccc(F)cc2Cl)s1)C(C)C |
| InChI | InChI=1S/C17H21ClFNS/c1-4-9-20-17(11(2)3)16-8-7-15(21-16)13-6-5-12(19)10-14(13)18/h5-8,10-11,17,20H,4,9H2,1-3H3 |
| InChIKey | GDDPXOYCWCLPEH-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |