C17H21BrClNS — CID 81280056
1-[5-(2-bromo-5-chlorophenyl)thiophen-2-yl]-2-methyl-N-propylpropan-1-amine (PubChem CID 81280056) has the molecular formula C17H21BrClNS and a molecular weight of 386.79 g/mol. Its IUPAC name is 1-[5-(2-bromo-5-chlorophenyl)thiophen-2-yl]-2-methyl-N-propylpropan-1-amine.
| Compound Name | 1-[5-(2-bromo-5-chlorophenyl)thiophen-2-yl]-2-methyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 81280056 |
| Molecular Formula | C17H21BrClNS |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 1-[5-(2-bromo-5-chlorophenyl)thiophen-2-yl]-2-methyl-N-propylpropan-1-amine |
| SMILES | CCCNC(c1ccc(-c2cc(Cl)ccc2Br)s1)C(C)C |
| InChI | InChI=1S/C17H21BrClNS/c1-4-9-20-17(11(2)3)16-8-7-15(21-16)13-10-12(19)5-6-14(13)18/h5-8,10-11,17,20H,4,9H2,1-3H3 |
| InChIKey | GTSQJEVSPJXXCC-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |