C16H18BrF2NS — CID 107615065
1-[5-(4-bromo-2,5-difluorophenyl)thiophen-2-yl]-N-ethyl-2-methylpropan-1-amine (PubChem CID 107615065) has the molecular formula C16H18BrF2NS and a molecular weight of 374.29 g/mol. Its IUPAC name is 1-[5-(4-bromo-2,5-difluorophenyl)thiophen-2-yl]-N-ethyl-2-methylpropan-1-amine.
| Compound Name | 1-[5-(4-bromo-2,5-difluorophenyl)thiophen-2-yl]-N-ethyl-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 107615065 |
| Molecular Formula | C16H18BrF2NS |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 1-[5-(4-bromo-2,5-difluorophenyl)thiophen-2-yl]-N-ethyl-2-methylpropan-1-amine |
| SMILES | CCNC(c1ccc(-c2cc(F)c(Br)cc2F)s1)C(C)C |
| InChI | InChI=1S/C16H18BrF2NS/c1-4-20-16(9(2)3)15-6-5-14(21-15)10-7-13(19)11(17)8-12(10)18/h5-9,16,20H,4H2,1-3H3 |
| InChIKey | OGYYXRZIXFLSLL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|