C13H12F3NS — CID 62810581
N-methyl-1-[5-(2,4,5-trifluorophenyl)thiophen-2-yl]ethanamine (PubChem CID 62810581) has the molecular formula C13H12F3NS and a molecular weight of 271.31 g/mol. Its IUPAC name is N-methyl-1-[5-(2,4,5-trifluorophenyl)thiophen-2-yl]ethanamine.
| Compound Name | N-methyl-1-[5-(2,4,5-trifluorophenyl)thiophen-2-yl]ethanamine |
|---|---|
| PubChem CID | 62810581 |
| Molecular Formula | C13H12F3NS |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | N-methyl-1-[5-(2,4,5-trifluorophenyl)thiophen-2-yl]ethanamine |
| SMILES | CNC(C)c1ccc(-c2cc(F)c(F)cc2F)s1 |
| InChI | InChI=1S/C13H12F3NS/c1-7(17-2)12-3-4-13(18-12)8-5-10(15)11(16)6-9(8)14/h3-7,17H,1-2H3 |
| InChIKey | OOXHFUGDURQBAV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|