C16H18ClNS — CID 43287807
1-[5-(2-chloro-4-methylphenyl)thiophen-2-yl]-1-cyclopropyl-N-methylmethanamine (PubChem CID 43287807) has the molecular formula C16H18ClNS and a molecular weight of 291.85 g/mol. Its IUPAC name is 1-[5-(2-chloro-4-methylphenyl)thiophen-2-yl]-1-cyclopropyl-N-methylmethanamine.
| Compound Name | 1-[5-(2-chloro-4-methylphenyl)thiophen-2-yl]-1-cyclopropyl-N-methylmethanamine |
|---|---|
| PubChem CID | 43287807 |
| Molecular Formula | C16H18ClNS |
| Molecular Weight | 291.85 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 1-[5-(2-chloro-4-methylphenyl)thiophen-2-yl]-1-cyclopropyl-N-methylmethanamine |
| SMILES | CNC(c1ccc(-c2ccc(C)cc2Cl)s1)C1CC1 |
| InChI | InChI=1S/C16H18ClNS/c1-10-3-6-12(13(17)9-10)14-7-8-15(19-14)16(18-2)11-4-5-11/h3,6-9,11,16,18H,4-5H2,1-2H3 |
| InChIKey | VLFDLBOYOGCZAK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.85 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |