C11H18N4O3S — CID 43290764
N-(3-amino-3-sulfanylidenepropyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methylacetamide (PubChem CID 43290764) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methylacetamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 43290764 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methylacetamide |
| SMILES | CN(CCC(N)=S)C(=O)CN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C11H18N4O3S/c1-11(2)9(17)15(10(18)13-11)6-8(16)14(3)5-4-7(12)19/h4-6H2,1-3H3,(H2,12,19)(H,13,18) |
| InChIKey | GUXVAGSMHRLMHD-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|