C13H13N3O3S — CID 43290875
4-[2-(3,6-dioxo-1H-pyridazin-2-yl)ethoxy]benzenecarbothioamide (PubChem CID 43290875) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 4-[2-(3,6-dioxo-1H-pyridazin-2-yl)ethoxy]benzenecarbothioamide.
| Compound Name | 4-[2-(3,6-dioxo-1H-pyridazin-2-yl)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 43290875 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 4-[2-(3,6-dioxo-1H-pyridazin-2-yl)ethoxy]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(OCCn2[nH]c(=O)ccc2=O)cc1 |
| InChI | InChI=1S/C13H13N3O3S/c14-13(20)9-1-3-10(4-2-9)19-8-7-16-12(18)6-5-11(17)15-16/h1-6H,7-8H2,(H2,14,20)(H,15,17) |
| InChIKey | PTVOKOPWKAIYLA-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|