C15H16N2O3S — CID 64835106
4-[3-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)propoxy]benzenecarbothioamide (PubChem CID 64835106) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is 4-[3-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)propoxy]benzenecarbothioamide.
| Compound Name | 4-[3-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)propoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 64835106 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 4-[3-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)propoxy]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(OCCCN2C(=O)C3CC3C2=O)cc1 |
| InChI | InChI=1S/C15H16N2O3S/c16-13(21)9-2-4-10(5-3-9)20-7-1-6-17-14(18)11-8-12(11)15(17)19/h2-5,11-12H,1,6-8H2,(H2,16,21) |
| InChIKey | DCAAPIBMJKPXBN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|