C15H22ClN3OS — CID 43296286
N-(2-amino-5-chlorophenyl)-4-[methyl(thiolan-3-yl)amino]butanamide (PubChem CID 43296286) has the molecular formula C15H22ClN3OS and a molecular weight of 327.88 g/mol. Its IUPAC name is N-(2-amino-5-chlorophenyl)-4-[methyl(thiolan-3-yl)amino]butanamide.
| Compound Name | N-(2-amino-5-chlorophenyl)-4-[methyl(thiolan-3-yl)amino]butanamide |
|---|---|
| PubChem CID | 43296286 |
| Molecular Formula | C15H22ClN3OS |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-(2-amino-5-chlorophenyl)-4-[methyl(thiolan-3-yl)amino]butanamide |
| SMILES | CN(CCCC(=O)Nc1cc(Cl)ccc1N)C1CCSC1 |
| InChI | InChI=1S/C15H22ClN3OS/c1-19(12-6-8-21-10-12)7-2-3-15(20)18-14-9-11(16)4-5-13(14)17/h4-5,9,12H,2-3,6-8,10,17H2,1H3,(H,18,20) |
| InChIKey | XCPULSZPMCNFJO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|