C14H16ClN5O — CID 29032604
N-(2-amino-5-chlorophenyl)-4-[bis(cyanomethyl)amino]butanamide (PubChem CID 29032604) has the molecular formula C14H16ClN5O and a molecular weight of 305.77 g/mol. Its IUPAC name is N-(2-amino-5-chlorophenyl)-4-[bis(cyanomethyl)amino]butanamide.
| Compound Name | N-(2-amino-5-chlorophenyl)-4-[bis(cyanomethyl)amino]butanamide |
|---|---|
| PubChem CID | 29032604 |
| Molecular Formula | C14H16ClN5O |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-(2-amino-5-chlorophenyl)-4-[bis(cyanomethyl)amino]butanamide |
| SMILES | N#CCN(CC#N)CCCC(=O)Nc1cc(Cl)ccc1N |
| InChI | InChI=1S/C14H16ClN5O/c15-11-3-4-12(18)13(10-11)19-14(21)2-1-7-20(8-5-16)9-6-17/h3-4,10H,1-2,7-9,18H2,(H,19,21) |
| InChIKey | RTMSYBGEHYGCAF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|