C13H14FN5O — CID 18071045
N-(3-amino-4-fluorophenyl)-3-[bis(cyanomethyl)amino]propanamide (PubChem CID 18071045) has the molecular formula C13H14FN5O and a molecular weight of 275.29 g/mol. Its IUPAC name is N-(3-amino-4-fluorophenyl)-3-[bis(cyanomethyl)amino]propanamide.
| Compound Name | N-(3-amino-4-fluorophenyl)-3-[bis(cyanomethyl)amino]propanamide |
|---|---|
| PubChem CID | 18071045 |
| Molecular Formula | C13H14FN5O |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-(3-amino-4-fluorophenyl)-3-[bis(cyanomethyl)amino]propanamide |
| SMILES | N#CCN(CC#N)CCC(=O)Nc1ccc(F)c(N)c1 |
| InChI | InChI=1S/C13H14FN5O/c14-11-2-1-10(9-12(11)17)18-13(20)3-6-19(7-4-15)8-5-16/h1-2,9H,3,6-8,17H2,(H,18,20) |
| InChIKey | AUAVNOKPFUUDBS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|