C15H22FN3O — CID 63955514
N-(3-amino-4-fluorophenyl)-3-[cyclopropylmethyl(ethyl)amino]propanamide (PubChem CID 63955514) has the molecular formula C15H22FN3O and a molecular weight of 279.36 g/mol. Its IUPAC name is N-(3-amino-4-fluorophenyl)-3-[cyclopropylmethyl(ethyl)amino]propanamide.
| Compound Name | N-(3-amino-4-fluorophenyl)-3-[cyclopropylmethyl(ethyl)amino]propanamide |
|---|---|
| PubChem CID | 63955514 |
| Molecular Formula | C15H22FN3O |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-(3-amino-4-fluorophenyl)-3-[cyclopropylmethyl(ethyl)amino]propanamide |
| SMILES | CCN(CCC(=O)Nc1ccc(F)c(N)c1)CC1CC1 |
| InChI | InChI=1S/C15H22FN3O/c1-2-19(10-11-3-4-11)8-7-15(20)18-12-5-6-13(16)14(17)9-12/h5-6,9,11H,2-4,7-8,10,17H2,1H3,(H,18,20) |
| InChIKey | KQUTWIRLWCNPMX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|