C9H19N3OS — CID 43296699
N'-hydroxy-2-methyl-3-[methyl(thiolan-3-yl)amino]propanimidamide (PubChem CID 43296699) has the molecular formula C9H19N3OS and a molecular weight of 217.34 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-3-[methyl(thiolan-3-yl)amino]propanimidamide.
| Compound Name | N'-hydroxy-2-methyl-3-[methyl(thiolan-3-yl)amino]propanimidamide |
|---|---|
| PubChem CID | 43296699 |
| Molecular Formula | C9H19N3OS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N'-hydroxy-2-methyl-3-[methyl(thiolan-3-yl)amino]propanimidamide |
| SMILES | CC(CN(C)C1CCSC1)/C(N)=N/O |
| InChI | InChI=1S/C9H19N3OS/c1-7(9(10)11-13)5-12(2)8-3-4-14-6-8/h7-8,13H,3-6H2,1-2H3,(H2,10,11) |
| InChIKey | NJCZLOVXNJUCND-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|