C10H20F3N3OS — CID 103370214
3,3,3-trifluoro-N'-hydroxy-2-[[methyl(4-methylsulfanylbutan-2-yl)amino]methyl]propanimidamide (PubChem CID 103370214) has the molecular formula C10H20F3N3OS and a molecular weight of 287.35 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[[methyl(4-methylsulfanylbutan-2-yl)amino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[[methyl(4-methylsulfanylbutan-2-yl)amino]methyl]propanimidamide |
|---|---|
| PubChem CID | 103370214 |
| Molecular Formula | C10H20F3N3OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[[methyl(4-methylsulfanylbutan-2-yl)amino]methyl]propanimidamide |
| SMILES | CSCCC(C)N(C)CC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C10H20F3N3OS/c1-7(4-5-18-3)16(2)6-8(9(14)15-17)10(11,12)13/h7-8,17H,4-6H2,1-3H3,(H2,14,15) |
| InChIKey | SMPVOZQPMQSNCR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|