C15H17NO3S — CID 43296850
3-[[methyl(thiolan-3-yl)amino]methyl]-1-benzofuran-2-carboxylic acid (PubChem CID 43296850) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 3-[[methyl(thiolan-3-yl)amino]methyl]-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-[[methyl(thiolan-3-yl)amino]methyl]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 43296850 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-[[methyl(thiolan-3-yl)amino]methyl]-1-benzofuran-2-carboxylic acid |
| SMILES | CN(Cc1c(C(=O)O)oc2ccccc12)C1CCSC1 |
| InChI | InChI=1S/C15H17NO3S/c1-16(10-6-7-20-9-10)8-12-11-4-2-3-5-13(11)19-14(12)15(17)18/h2-5,10H,6-9H2,1H3,(H,17,18) |
| InChIKey | UHVNWNFZPKKKIR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |