C12H17NO3S — CID 43477431
2-methyl-5-[[methyl(thiolan-3-yl)amino]methyl]furan-3-carboxylic acid (PubChem CID 43477431) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-methyl-5-[[methyl(thiolan-3-yl)amino]methyl]furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-[[methyl(thiolan-3-yl)amino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 43477431 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-methyl-5-[[methyl(thiolan-3-yl)amino]methyl]furan-3-carboxylic acid |
| SMILES | Cc1oc(CN(C)C2CCSC2)cc1C(=O)O |
| InChI | InChI=1S/C12H17NO3S/c1-8-11(12(14)15)5-10(16-8)6-13(2)9-3-4-17-7-9/h5,9H,3-4,6-7H2,1-2H3,(H,14,15) |
| InChIKey | XEWZXMPZOHGGLN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |