C11H17NO2S — CID 115880216
[5-[[methyl(thiolan-3-yl)amino]methyl]furan-2-yl]methanol (PubChem CID 115880216) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is [5-[[methyl(thiolan-3-yl)amino]methyl]furan-2-yl]methanol.
| Compound Name | [5-[[methyl(thiolan-3-yl)amino]methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 115880216 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | [5-[[methyl(thiolan-3-yl)amino]methyl]furan-2-yl]methanol |
| SMILES | CN(Cc1ccc(CO)o1)C1CCSC1 |
| InChI | InChI=1S/C11H17NO2S/c1-12(9-4-5-15-8-9)6-10-2-3-11(7-13)14-10/h2-3,9,13H,4-8H2,1H3 |
| InChIKey | VUWJVJWSVXDAFE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |