C15H23NO3 — CID 39903877
methyl 5-[[cyclohexyl(methyl)amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 39903877) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is methyl 5-[[cyclohexyl(methyl)amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[cyclohexyl(methyl)amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 39903877 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | methyl 5-[[cyclohexyl(methyl)amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CN(C)C2CCCCC2)oc1C |
| InChI | InChI=1S/C15H23NO3/c1-11-14(15(17)18-3)9-13(19-11)10-16(2)12-7-5-4-6-8-12/h9,12H,4-8,10H2,1-3H3 |
| InChIKey | DVPCCKPNMKZCDJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |