C14H23N3O2 — CID 55214014
5-[[cyclohexyl(methyl)amino]methyl]-3-methylfuran-2-carbohydrazide (PubChem CID 55214014) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 5-[[cyclohexyl(methyl)amino]methyl]-3-methylfuran-2-carbohydrazide.
| Compound Name | 5-[[cyclohexyl(methyl)amino]methyl]-3-methylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 55214014 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 5-[[cyclohexyl(methyl)amino]methyl]-3-methylfuran-2-carbohydrazide |
| SMILES | Cc1cc(CN(C)C2CCCCC2)oc1C(=O)NN |
| InChI | InChI=1S/C14H23N3O2/c1-10-8-12(19-13(10)14(18)16-15)9-17(2)11-6-4-3-5-7-11/h8,11H,3-7,9,15H2,1-2H3,(H,16,18) |
| InChIKey | HFPBANHPTPXBDI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|