C15H25N3O2 — CID 63572192
5-[[cycloheptyl(methyl)amino]methyl]-3-methylfuran-2-carbohydrazide (PubChem CID 63572192) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 5-[[cycloheptyl(methyl)amino]methyl]-3-methylfuran-2-carbohydrazide.
| Compound Name | 5-[[cycloheptyl(methyl)amino]methyl]-3-methylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 63572192 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 5-[[cycloheptyl(methyl)amino]methyl]-3-methylfuran-2-carbohydrazide |
| SMILES | Cc1cc(CN(C)C2CCCCCC2)oc1C(=O)NN |
| InChI | InChI=1S/C15H25N3O2/c1-11-9-13(20-14(11)15(19)17-16)10-18(2)12-7-5-3-4-6-8-12/h9,12H,3-8,10,16H2,1-2H3,(H,17,19) |
| InChIKey | NEFOWSLMSGUZOX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|