About (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(2-methylphenyl)methanamine
(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(2-methylphenyl)methanamine (PubChem CID 43297145) has the molecular formula C17H19NO
and a molecular weight of 253.34 g/mol. Its IUPAC name is (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(2-methylphenyl)methanamine.
Molecular Properties
| Compound Name | (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(2-methylphenyl)methanamine |
| PubChem CID | 43297145 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(2-methylphenyl)methanamine |
| SMILES | Cc1ccccc1C(N)c1ccc2c(c1)CC(C)O2 |
| InChI | InChI=1S/C17H19NO/c1-11-5-3-4-6-15(11)17(18)13-7-8-16-14(10-13)9-12(2)19-16/h3-8,10,12,17H,9,18H2,1-2H3 |
| InChIKey | PLPSCVXCZSMCAX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(2-methylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(2-methylphenyl)methanamine?
The IUPAC name of (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(2-methylphenyl)methanamine (CID 43297145) is (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(2-methylphenyl)methanamine.
What is the SMILES notation for (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(2-methylphenyl)methanamine?
The canonical SMILES for (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(2-methylphenyl)methanamine is Cc1ccccc1C(N)c1ccc2c(c1)CC(C)O2.
What is the InChIKey of (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(2-methylphenyl)methanamine?
The InChIKey is PLPSCVXCZSMCAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO/c1-11-5-3-4-6-15(11)17(18)13-7-8-16-14(10-13)9-12(2)19-16/h3-8,10,12,17H,9,18H2,1-2H3.
What are the key properties of (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(2-methylphenyl)methanamine?
(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(2-methylphenyl)methanamine has a molecular weight of 253.34 g/mol, XLogP of 3.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(2-methylphenyl)methanamine is sourced from PubChem (CID 43297145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).