C10H14N2O2S — CID 43301045
6-(1,3-dioxan-4-ylmethylsulfanyl)pyridin-3-amine (PubChem CID 43301045) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 6-(1,3-dioxan-4-ylmethylsulfanyl)pyridin-3-amine.
| Compound Name | 6-(1,3-dioxan-4-ylmethylsulfanyl)pyridin-3-amine |
|---|---|
| PubChem CID | 43301045 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 6-(1,3-dioxan-4-ylmethylsulfanyl)pyridin-3-amine |
| SMILES | Nc1ccc(SCC2CCOCO2)nc1 |
| InChI | InChI=1S/C10H14N2O2S/c11-8-1-2-10(12-5-8)15-6-9-3-4-13-7-14-9/h1-2,5,9H,3-4,6-7,11H2 |
| InChIKey | PXVLNANCRLGDPX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |