C11H14ClNO2S — CID 43304493
3-chloro-2-(1,3-dioxan-4-ylmethylsulfanyl)aniline (PubChem CID 43304493) has the molecular formula C11H14ClNO2S and a molecular weight of 259.76 g/mol. Its IUPAC name is 3-chloro-2-(1,3-dioxan-4-ylmethylsulfanyl)aniline.
| Compound Name | 3-chloro-2-(1,3-dioxan-4-ylmethylsulfanyl)aniline |
|---|---|
| PubChem CID | 43304493 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 3-chloro-2-(1,3-dioxan-4-ylmethylsulfanyl)aniline |
| SMILES | Nc1cccc(Cl)c1SCC1CCOCO1 |
| InChI | InChI=1S/C11H14ClNO2S/c12-9-2-1-3-10(13)11(9)16-6-8-4-5-14-7-15-8/h1-3,8H,4-7,13H2 |
| InChIKey | IAZDWUYNXUYPAO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|