C12H14N4O2S — CID 75412675
5-(1,3-dioxan-4-ylmethylsulfanyl)-1-phenyltetrazole (PubChem CID 75412675) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 5-(1,3-dioxan-4-ylmethylsulfanyl)-1-phenyltetrazole.
| Compound Name | 5-(1,3-dioxan-4-ylmethylsulfanyl)-1-phenyltetrazole |
|---|---|
| PubChem CID | 75412675 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 5-(1,3-dioxan-4-ylmethylsulfanyl)-1-phenyltetrazole |
| SMILES | c1ccc(-n2nnnc2SCC2CCOCO2)cc1 |
| InChI | InChI=1S/C12H14N4O2S/c1-2-4-10(5-3-1)16-12(13-14-15-16)19-8-11-6-7-17-9-18-11/h1-5,11H,6-9H2 |
| InChIKey | PJJUQKLQFOMGDF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |