C14H18N4OS — CID 43301358
2-[(5-amino-2-pyridinyl)sulfanyl]-N-(1-cyanocyclohexyl)acetamide (PubChem CID 43301358) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-[(5-amino-2-pyridinyl)sulfanyl]-N-(1-cyanocyclohexyl)acetamide.
| Compound Name | 2-[(5-amino-2-pyridinyl)sulfanyl]-N-(1-cyanocyclohexyl)acetamide |
|---|---|
| PubChem CID | 43301358 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-[(5-amino-2-pyridinyl)sulfanyl]-N-(1-cyanocyclohexyl)acetamide |
| SMILES | N#CC1(NC(=O)CSc2ccc(N)cn2)CCCCC1 |
| InChI | InChI=1S/C14H18N4OS/c15-10-14(6-2-1-3-7-14)18-12(19)9-20-13-5-4-11(16)8-17-13/h4-5,8H,1-3,6-7,9,16H2,(H,18,19) |
| InChIKey | JYYOZBCLVUMHRG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |