C14H22N4O2S — CID 43301773
2-[[2-[(6-amino-3-pyridinyl)sulfanyl]acetyl]-ethylamino]-N-propan-2-ylacetamide (PubChem CID 43301773) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-[[2-[(6-amino-3-pyridinyl)sulfanyl]acetyl]-ethylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[[2-[(6-amino-3-pyridinyl)sulfanyl]acetyl]-ethylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 43301773 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-[[2-[(6-amino-3-pyridinyl)sulfanyl]acetyl]-ethylamino]-N-propan-2-ylacetamide |
| SMILES | CCN(CC(=O)NC(C)C)C(=O)CSc1ccc(N)nc1 |
| InChI | InChI=1S/C14H22N4O2S/c1-4-18(8-13(19)17-10(2)3)14(20)9-21-11-5-6-12(15)16-7-11/h5-7,10H,4,8-9H2,1-3H3,(H2,15,16)(H,17,19) |
| InChIKey | BLADQFDFHIWBRD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |