C13H10BrN3O2S — CID 43305771
5-bromo-2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]aniline (PubChem CID 43305771) has the molecular formula C13H10BrN3O2S and a molecular weight of 352.21 g/mol. Its IUPAC name is 5-bromo-2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]aniline.
| Compound Name | 5-bromo-2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]aniline |
|---|---|
| PubChem CID | 43305771 |
| Molecular Formula | C13H10BrN3O2S |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 5-bromo-2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]aniline |
| SMILES | Nc1cc(Br)ccc1SCc1noc(-c2ccco2)n1 |
| InChI | InChI=1S/C13H10BrN3O2S/c14-8-3-4-11(9(15)6-8)20-7-12-16-13(19-17-12)10-2-1-5-18-10/h1-6H,7,15H2 |
| InChIKey | DXEDEYZRWOQZHS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|