C13H14N2O5S — CID 43311708
[5-methoxy-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2-nitrophenyl]methanol (PubChem CID 43311708) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is [5-methoxy-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2-nitrophenyl]methanol.
| Compound Name | [5-methoxy-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2-nitrophenyl]methanol |
|---|---|
| PubChem CID | 43311708 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | [5-methoxy-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2-nitrophenyl]methanol |
| SMILES | COc1cc(CO)c([N+](=O)[O-])cc1OCc1csc(C)n1 |
| InChI | InChI=1S/C13H14N2O5S/c1-8-14-10(7-21-8)6-20-13-4-11(15(17)18)9(5-16)3-12(13)19-2/h3-4,7,16H,5-6H2,1-2H3 |
| InChIKey | PXZMOMUANKSTHO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|